[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]methanone structure
|
Common Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 72141-56-1 | Molecular Weight | 575.00200 | |
| Density | 1.467g/cm3 | Boiling Point | 715ºC at 760 mmHg | |
| Molecular Formula | C27H22ClF3N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 386.2ºC | |
| Name | [4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-[4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 715ºC at 760 mmHg |
| Molecular Formula | C27H22ClF3N4O3S |
| Molecular Weight | 575.00200 |
| Flash Point | 386.2ºC |
| Exact Mass | 574.10500 |
| PSA | 90.99000 |
| LogP | 6.82690 |
| Index of Refraction | 1.649 |
| InChIKey | HVICCLWOVOURCK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Nc2ccnc3cc(C(F)(F)F)ccc23)cc1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
|
~75%
[4-(4-chlorophe... CAS#:72141-56-1 |
| Literature: The Upjohn Company Patent: US4167567 A1, 1979 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Piperazine,1-[(4-chlorophenyl)sulfonyl]-4-[4-[[7-(trifluoromethyl)-4-quinolinyl]amino]benzoyl] |
| 1-[(4-chlorophenyl)sulfonyl]4-[4-[[7-(trifluoromethyl)-4-quinolinyl]amino]benzoyl]piperazine |