N,N-dimethyl-1,1-dioxo-3-thiophen-2-yl-thietan-3-amine structure
|
Common Name | N,N-dimethyl-1,1-dioxo-3-thiophen-2-yl-thietan-3-amine | ||
|---|---|---|---|---|
| CAS Number | 72000-09-0 | Molecular Weight | 231.33500 | |
| Density | 1.35g/cm3 | Boiling Point | 415.2ºC at 760 mmHg | |
| Molecular Formula | C9H13NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9ºC | |
| Name | N,N-dimethyl-1,1-dioxo-3-thiophen-2-ylthietan-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 415.2ºC at 760 mmHg |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.33500 |
| Flash Point | 204.9ºC |
| Exact Mass | 231.03900 |
| PSA | 74.00000 |
| LogP | 2.01420 |
| Index of Refraction | 1.605 |
| InChIKey | WAWXBJAIVRJIFF-UHFFFAOYSA-N |
| SMILES | CN(C)C1(c2cccs2)CS(=O)(=O)C1 |
|
~91%
N,N-dimethyl-1,... CAS#:72000-09-0 |
| Literature: Koikov, L. N.; Terent'ev, P. B.; Kulikov, N. S. Journal of Organic Chemistry USSR (English Translation), 1981 , vol. 17, p. 960 - 964 Zhurnal Organicheskoi Khimii, 1981 , vol. 17, # 5 p. 1087 - 1093 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2-thienyl)-3-(N,N-dimethylamino)thietane 1,1-dioxide |