CHEMBRDG-BB 5127943
Modify Date: 2024-02-15 19:50:08
CHEMBRDG-BB 5127943 structure
|
Common Name | CHEMBRDG-BB 5127943 | ||
|---|---|---|---|---|
| CAS Number | 71969-25-0 | Molecular Weight | 225.28600 | |
| Density | 1.113g/cm3 | Boiling Point | 420.8ºC at 760 mmHg | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | (4-aminophenyl)-(3,4-dimethylphenyl)methanone |
|---|
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 420.8ºC at 760 mmHg |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Flash Point | 208.3ºC |
| Exact Mass | 225.11500 |
| PSA | 43.09000 |
| LogP | 3.69780 |
| Index of Refraction | 1.607 |
| InChIKey | YDKUTIXKMCAGFZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2ccc(N)cc2)cc1C |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |