bis(2,3-epoxypropyl) terephthalate
Modify Date: 2025-09-09 23:36:12
bis(2,3-epoxypropyl) terephthalate structure
|
Common Name | bis(2,3-epoxypropyl) terephthalate | ||
|---|---|---|---|---|
| CAS Number | 7195-44-0 | Molecular Weight | 278.25700 | |
| Density | 1.351g/cm3 | Boiling Point | 426.2ºC at 760 mmHg | |
| Molecular Formula | C14H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.1ºC | |
| Name | Bis(2-oxiranylmethyl) terephthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 426.2ºC at 760 mmHg |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.25700 |
| Flash Point | 191.1ºC |
| Exact Mass | 278.07900 |
| PSA | 77.66000 |
| LogP | 0.79780 |
| Index of Refraction | 1.569 |
| InChIKey | NEPKLUNSRVEBIX-UHFFFAOYSA-N |
| SMILES | O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)cc1 |
|
~85%
bis(2,3-epoxypr... CAS#:7195-44-0 |
| Literature: The Dow Chemical Company Patent: US5036154 A1, 1991 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Terephthalsaeure-diglycidylester |
| diglycidyl terephthalate |
| o-Phthalic acid diglycidyl ester |
| terephthalic acid diglycidyl ester |
| 1,2-diglycidyl phthalate |
| diglycidyl phthalate |
| Phthalic acid diglycidyl ester |
| diglycidyl orthophthalate |
| Ak-838 |
| phthalic acid bis-oxiranylmethyl ester |
| Terephthalsaeure-bis-<2,3-epoxy-propyl-ester> |
| terephthalic acid bis-oxiranylmethyl ester |
| Phthalsaeure-diglycidylester |
| bis(2,3-epoxypropyl) terephthalate |
| Diglycidylphthalat |
| Diglycidylester kyseliny ftalove |
| Phthalsaeure-bis-<2,3-epoxy-propyl-ester> |
| DIGLYCIDYLESTEROFPHTHALICACID |