10-nitro-9,10-dihydro-9,10-ethanoanthracene-11-carbonitrile structure
|
Common Name | 10-nitro-9,10-dihydro-9,10-ethanoanthracene-11-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 71948-90-8 | Molecular Weight | 276.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-nitro-9,10-dihydro-9,10-ethanoanthracene-11-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H12N2O2 |
|---|---|
| Molecular Weight | 276.28900 |
| Exact Mass | 276.09000 |
| PSA | 69.61000 |
| LogP | 3.71888 |
| InChIKey | VDCHUBCABOYHKH-UHFFFAOYSA-N |
| SMILES | N#CC1CC2c3ccccc3C1([N+](=O)[O-])c1ccccc12 |
|
~%
10-nitro-9,10-d... CAS#:71948-90-8 |
| Literature: Meek,J.S. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 2566 - 2569 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-Nitro-12-cyano-9,10-dihydro-9,10-ethano-anthracen |
| 9-Nitro-1,2,3,4-tetrahydrophenanthrene-8-carboxylic acid |