yekyxqaijsozra-uhfffaoysa structure
|
Common Name | yekyxqaijsozra-uhfffaoysa | ||
|---|---|---|---|---|
| CAS Number | 71925-38-7 | Molecular Weight | 284.09300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | yekyxqaijsozra-uhfffaoysa |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9IO |
|---|---|
| Molecular Weight | 284.09300 |
| Exact Mass | 283.97000 |
| PSA | 17.07000 |
| LogP | 2.83490 |
|
~%
yekyxqaijsozra-... CAS#:71925-38-7 |
| Literature: Paquette,L.A. et al. Journal of the American Chemical Society, 1979 , vol. 101, # 20 p. 5972 - 5980 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-Methanonaphthalen-2(1H)-one,3,4-dihydro-5-iodo |
| InChI=1/C11H9IO/c12-9-3-1-2-7-8-4-6(11(7)9)5-10(8)13/h1-3,6,8H,4-5H2 |
| 5-iodo-benzobicyclo(2.2.1)hepten-2-one |
| 5-iodobenzonorbornen-2-one |
| 5-Jodbenzonorbornen-2-on |