dihydro-3-(tetrapropenyl)furan-2,5-dione, compound with methyl-1H-benzotriazole
Modify Date: 2025-09-03 18:26:31
dihydro-3-(tetrapropenyl)furan-2,5-dione, compound with methyl-1H-benzotriazole structure
|
Common Name | dihydro-3-(tetrapropenyl)furan-2,5-dione, compound with methyl-1H-benzotriazole | ||
|---|---|---|---|---|
| CAS Number | 71829-80-6 | Molecular Weight | 393.47900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-2H-benzotriazole,3-[(2E,4Z,6E)-5-methylocta-2,4,6-trien-4-yl]-4-[(E)-prop-1-enyl]oxolane-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H27N3O3 |
|---|---|
| Molecular Weight | 393.47900 |
| Exact Mass | 393.20500 |
| PSA | 84.94000 |
| LogP | 4.61330 |
| InChIKey | CIEUJABIHXIFPX-RWZOWGHDSA-N |
| SMILES | CC=CC(C)=C(C=CC)C1C(=O)OC(=O)C1C=CC.Cc1cccc2n[nH]nc12 |
| 2,5-Furandione,dihydro-3-(tetrapropenyl)-,compd. with methyl-1H-benzotriazole |
| Dihydro-3-(tetrapropenyl)furan-2,5-dione,compound with methyl-1H-benzotriazole |
| 2,5-Furandione,dihydro-3-(tetrapropenyl)-,compd. with 6(or 7)-methyl-1H-benzotriazole (1:) |
| Dihydro-3-(tetrapropenyl)-2,5-furandione,compd. with methyl-1H-benzotriazole |
| EINECS 276-047-8 |