N-hydroxy-N-(4-phenoxyphenyl)acetamide structure
|
Common Name | N-hydroxy-N-(4-phenoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 71708-92-4 | Molecular Weight | 243.25800 | |
| Density | 1.262g/cm3 | Boiling Point | 402.4ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | N-hydroxy-N-(4-phenoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 402.4ºC at 760 mmHg |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.25800 |
| Flash Point | 197.2ºC |
| Exact Mass | 243.09000 |
| PSA | 49.77000 |
| LogP | 3.22100 |
| Index of Refraction | 1.63 |
| InChIKey | CBCRJEHXQUNGAY-UHFFFAOYSA-N |
| SMILES | CC(=O)N(O)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Hydroxy-4'-phenoxy-acetanilid |
| 4'-Hydroxyacetylaminobiphenyl ether |
| Acetohydroxamic acid,N-(p-phenoxyphenyl) |
| ACETAMIDE,N-HYDROXY-N-(4-PHENOXYPHENYL) |