3',4'-DICHLOROPIVALANILIDE structure
|
Common Name | 3',4'-DICHLOROPIVALANILIDE | ||
|---|---|---|---|---|
| CAS Number | 7160-22-7 | Molecular Weight | 246.13300 | |
| Density | 1.255g/cm3 | Boiling Point | 377.1ºC at 760 mmHg | |
| Molecular Formula | C11H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | N-(3,4-dichlorophenyl)-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 377.1ºC at 760 mmHg |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.13300 |
| Flash Point | 181.9ºC |
| Exact Mass | 245.03700 |
| PSA | 29.10000 |
| LogP | 4.05100 |
| Index of Refraction | 1.568 |
| InChIKey | WMFDYXPRRHDSQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~86%
3',4'-DICHLOROP... CAS#:7160-22-7 |
| Literature: Widdowson, Katherine Louisa; Jin, Qi Patent: US2003/55286 A1, 2003 ; US 20030055286 A1 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3',4'-Dichloropivalanilide |
| 3',4'-Dichlor-trimethylacetanilid |