1,1-Dimethyl-3-(3-nitrophenyl)urea
Modify Date: 2025-09-18 18:25:15
1,1-Dimethyl-3-(3-nitrophenyl)urea structure
|
Common Name | 1,1-Dimethyl-3-(3-nitrophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 7159-98-0 | Molecular Weight | 209.20200 | |
| Density | 1.323g/cm3 | Boiling Point | 399.2ºC at 760 mmHg | |
| Molecular Formula | C9H11N3O3 | Melting Point | 126 - 127 °C | |
| MSDS | N/A | Flash Point | 195.2ºC | |
| Name | 1,1-Dimethyl-3-(3-nitrophenyl)urea |
|---|
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 399.2ºC at 760 mmHg |
| Melting Point | 126 - 127 °C |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20200 |
| Flash Point | 195.2ºC |
| Exact Mass | 209.08000 |
| PSA | 78.16000 |
| LogP | 2.28450 |
| Index of Refraction | 1.618 |
| InChIKey | FRDCRCKHAAQIRU-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |