[phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid,prop-2-enoic acid
Modify Date: 2025-10-13 14:45:59
![[phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid,prop-2-enoic acid Structure](https://image.chemsrc.com/caspic/337/71550-13-5.png)
[phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid,prop-2-enoic acid structure
|
Common Name | [phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 71550-13-5 | Molecular Weight | 317.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H17NO8P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H17NO8P2 |
|---|---|
| Molecular Weight | 317.17000 |
| Exact Mass | 317.04300 |
| PSA | 175.22000 |
| LogP | 0.00180 |
| InChIKey | HQIZBHJXHXXKSH-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O.C=CCN(CP(=O)(O)O)CP(=O)(O)O |
| 2-Propenoic acid,polymer with P,P'-((2-propen-1-ylimino)bis(methylene))bis(phosphonic acid) |
| 2-Propenoic acid,polymer with ((2-propenylimino)bis(methylene))bis(phosphonic acid) |
| Acrylic acid,N,N-bis(phosphonomethylene)allylamine polymer |