Acetic acid,nitrosoiminodi-, bis(2-phenylhydrazide) (8CI) structure
|
Common Name | Acetic acid,nitrosoiminodi-, bis(2-phenylhydrazide) (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7155-39-7 | Molecular Weight | 342.35300 | |
| Density | 1.32g/cm3 | Boiling Point | 519.6ºC at 760mmHg | |
| Molecular Formula | C16H18N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268ºC | |
| Name | N,N-bis[2-oxo-2-(2-phenylhydrazinyl)ethyl]nitrous amide |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 519.6ºC at 760mmHg |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.35300 |
| Flash Point | 268ºC |
| Exact Mass | 342.14400 |
| PSA | 114.93000 |
| LogP | 2.18420 |
| Index of Refraction | 1.636 |
| InChIKey | GMCWBXDBYUUHBM-UHFFFAOYSA-N |
| SMILES | O=NN(CC(=O)NNc1ccccc1)CC(=O)NNc1ccccc1 |
|
~%
Acetic acid,nit... CAS#:7155-39-7 |
| Literature: Zimmer; Narayanaswamy Ohio Journal of Science, 1959 , vol. 59, p. 327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |