Propanedioic acid,2-butyl-2-phenyl-, 1,3-diethyl ester
Modify Date: 2025-10-11 17:13:21
Propanedioic acid,2-butyl-2-phenyl-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-butyl-2-phenyl-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7155-21-7 | Molecular Weight | 292.37000 | |
| Density | 1.049g/cm3 | Boiling Point | 363.2ºC at 760mmHg | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.8ºC | |
| Name | diethyl 2-butyl-2-phenylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 363.2ºC at 760mmHg |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37000 |
| Flash Point | 170.8ºC |
| Exact Mass | 292.16700 |
| PSA | 52.60000 |
| LogP | 3.24080 |
| Index of Refraction | 1.49 |
| InChIKey | NRHHEAFRICJREB-UHFFFAOYSA-N |
| SMILES | CCCCC(C(=O)OCC)(C(=O)OCC)c1ccccc1 |
|
~61%
Propanedioic ac... CAS#:7155-21-7 |
| Literature: Turro, Nicolas J.; Chow, Ming-Fea Journal of the American Chemical Society, 1980 , vol. 102, # 15 p. 5058 - 5064 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:24716-09-4| Butyl-phenyl-malonsaeure-diaethylester |
| butyl-phenyl-malonic acid diethyl ester |
| diethyl phenyl-n-butylmalonate |