3-methyl-1-phenyl-2-pyridin-2-yl-butan-1-one structure
|
Common Name | 3-methyl-1-phenyl-2-pyridin-2-yl-butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 7154-11-2 | Molecular Weight | 239.31200 | |
| Density | 1.061g/cm3 | Boiling Point | 356.2ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
| Name | 3-methyl-1-phenyl-2-pyridin-2-ylbutan-1-one |
|---|
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 356.2ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 177ºC |
| Exact Mass | 239.13100 |
| PSA | 29.96000 |
| LogP | 3.70410 |
| Index of Refraction | 1.558 |
| InChIKey | GOLAESQVRDHHNN-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)c1ccccc1)c1ccccn1 |
|
~%
3-methyl-1-phen... CAS#:7154-11-2 |
| Literature: Osuch; Levine Journal of Organic Chemistry, 1956 , vol. 21, p. 1099 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |