Benzene,1,1'-[1,2-ethanediylbis(thio)]bis[4-nitro- (9CI)
Modify Date: 2025-08-21 14:39:10
![Benzene,1,1'-[1,2-ethanediylbis(thio)]bis[4-nitro- (9CI) Structure](https://image.chemsrc.com/caspic/405/71532-93-9.png)
Benzene,1,1'-[1,2-ethanediylbis(thio)]bis[4-nitro- (9CI) structure
|
Common Name | Benzene,1,1'-[1,2-ethanediylbis(thio)]bis[4-nitro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 71532-93-9 | Molecular Weight | 336.38600 | |
| Density | 1.43g/cm3 | Boiling Point | 532.7ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276ºC | |
| Name | 2,5-dihydroindeno[1,2-c]pyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 532.7ºC at 760 mmHg |
| Molecular Formula | C14H12N2O4S2 |
| Molecular Weight | 336.38600 |
| Flash Point | 276ºC |
| Exact Mass | 336.02400 |
| PSA | 142.24000 |
| LogP | 5.43380 |
| Index of Refraction | 1.682 |
| InChIKey | VKPWHSPOXMGOCD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(SCCSc2ccc([N+](=O)[O-])cc2)cc1 |
|
~36%
Benzene,1,1'-[1... CAS#:71532-93-9 |
| Literature: Singh, Paramjit; Arora, Geeta Tetrahedron, 1988 , vol. 44, # 9 p. 2625 - 2632 |
|
~25%
Detail
|
| Literature: Singh, Paramjit; Arora, Geeta Tetrahedron, 1988 , vol. 44, # 9 p. 2625 - 2632 |
|
~%
Benzene,1,1'-[1... CAS#:71532-93-9 |
| Literature: Fromm; Benzinger; Schaefer Justus Liebigs Annalen der Chemie, 1912 , vol. 394, p. 331 |
|
~%
Benzene,1,1'-[1... CAS#:71532-93-9 |
| Literature: Flowers,W.T. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 1309 - 1321 |
| 1,2-bis(4-nitrophenylthio) ethane |
| Bis(4-nitrophenyl) diselenide |
| 4,4'-dinitrodiphenyl diselenide |
| Dithioaethylenglykol-bis-(4-nitro-phenylaether) |
| diselane,bis(4-nitrophenyl) |
| di(p-nitrophenyl) diselenide |
| Aethylen-bis-(4-nitro-phenylsulfid) |
| 1,2-bis(4-nitrophenyl)diselane |
| bis(4-nitrophenyl)diselane |
| bis(p-nirophenyl) diselenide |
| 1,2-Bis-(4-nitro-phenylmercapto)-aethan |
| 1,2-bis-(4-nitro-phenylsulfanyl)-ethane |