3-Isopropylbenzenesulfonyl chloride
Modify Date: 2025-08-26 03:53:50
3-Isopropylbenzenesulfonyl chloride structure
|
Common Name | 3-Isopropylbenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 71530-58-0 | Molecular Weight | 218.700 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 290.0±19.0 °C at 760 mmHg | |
| Molecular Formula | C9H11ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.2±21.5 °C | |
| Name | 3-propan-2-ylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.0±19.0 °C at 760 mmHg |
| Molecular Formula | C9H11ClO2S |
| Molecular Weight | 218.700 |
| Flash Point | 129.2±21.5 °C |
| Exact Mass | 218.016830 |
| PSA | 42.52000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | ZFVRVVPYKFLHAE-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(S(=O)(=O)Cl)c1 |
| HS Code | 2904909090 |
|---|
|
~%
Detail
|
| Literature: Krylov, E.N.; Odintsova, G.N. Journal of Organic Chemistry USSR (English Translation), 1982 , vol. 18, p. 1695 - 1701 Zhurnal Organicheskoi Khimii, 1982 , vol. 18, # 9 p. 1936 - 1942 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-isopropylbenzene-1-sulfonyl chloride |
| 3-(1-methylethyl)benzenesulphonyl chloride |
| 3-Isopropylbenzenesulfonyl chloride |
| Benzenesulfonyl chloride, 3-(1-methylethyl)- |
| 3-(1-methylethyl)benzenesulfonyl chloride |
| 3-(PROPAN-2-YL)BENZENE-1-SULFONYL CHLORIDE |
| m-cumenesulfonyl chloride |
| 3-Isopropylbenzene-1-sulphonyl chloride |