benzoic acid, compound with sulphamoyl chloride (1:1) structure
|
Common Name | benzoic acid, compound with sulphamoyl chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 71501-50-3 | Molecular Weight | 237.66100 | |
| Density | N/A | Boiling Point | 461.1ºC at 760mmHg | |
| Molecular Formula | C7H8ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzoic acid,sulfamoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 461.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H8ClNO4S |
| Molecular Weight | 237.66100 |
| Exact Mass | 236.98600 |
| PSA | 105.84000 |
| LogP | 2.59460 |
| InChIKey | RNHSRDAXJMGMRK-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)Cl.O=C(O)c1ccccc1 |
| einecs 275-578-2 |
| benzoic acid compound with sulphamoyl chloride (1:1) |