1H-Indole-3-methanamine,N,N-dimethyl-4-nitro- structure
|
Common Name | 1H-Indole-3-methanamine,N,N-dimethyl-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 7150-46-1 | Molecular Weight | 219.24000 | |
| Density | 1.287g/cm3 | Boiling Point | 377.9ºC at 760mmHg | |
| Molecular Formula | C11H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | N,N-dimethyl-1-(4-nitro-1H-indol-3-yl)methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 377.9ºC at 760mmHg |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24000 |
| Flash Point | 182.4ºC |
| Exact Mass | 219.10100 |
| PSA | 64.85000 |
| LogP | 2.66090 |
| Index of Refraction | 1.661 |
| InChIKey | NTWUAOHAQNZERF-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1c[nH]c2cccc([N+](=O)[O-])c12 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1h-indole-3-methanamine,n,n-dimethyl-4-nitro |
| 3-dimethylaminomethyl-4-nitroindole |
| 4-Nitro-3-(dimethylamino-methyl)-indol |
| dimethyl-(4-nitro-indol-3-ylmethyl)-amine |
| 4-NITROGRAMINE |
| 4-Nitro-gramin |
| 3-dimethylamino-4-nitroindole |