N-(4-chloro-5-methyl-2-nitro-phenyl)acetamide
Modify Date: 2025-08-25 11:40:04
N-(4-chloro-5-methyl-2-nitro-phenyl)acetamide structure
|
Common Name | N-(4-chloro-5-methyl-2-nitro-phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 7149-74-8 | Molecular Weight | 228.63200 | |
| Density | 1.406g/cm3 | Boiling Point | 407.7ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.4ºC | |
| Name | 6-Chlor-4-nitro-3-acetamino-toluol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 407.7ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63200 |
| Flash Point | 200.4ºC |
| Exact Mass | 228.03000 |
| PSA | 74.92000 |
| LogP | 3.11120 |
| Index of Refraction | 1.615 |
| InChIKey | RBYNSDLYWIQRQM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(C)c(Cl)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-chloro-5-m... CAS#:7149-74-8 |
| Literature: Morgan; Challenor Journal of the Chemical Society, 1921 , vol. 119, p. 1540 |
|
~%
N-(4-chloro-5-m... CAS#:7149-74-8 |
| Literature: Morgan; Challenor Journal of the Chemical Society, 1921 , vol. 119, p. 1540 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Acetylamino-5-chlor-4-methoxy-toluol |
| 4-Chlor-5-methyl-2-nitroacetanilid |
| 4-Chloro-5-methoxy-2-methylacetanilide |
| 5-Chlor-2-acetamino-4-methoxy-toluol |
| 6-Chlor-3-acetamino-p-kresol-methylaether |
| 5-Chlor-2-acetamino-4-methoxy-1-methyl-benzol |