1-(2,6-dichlorophenyl)-3-propan-2-ylurea
Modify Date: 2024-02-04 15:56:41
1-(2,6-dichlorophenyl)-3-propan-2-ylurea structure
|
Common Name | 1-(2,6-dichlorophenyl)-3-propan-2-ylurea | ||
|---|---|---|---|---|
| CAS Number | 71463-57-5 | Molecular Weight | 247.12100 | |
| Density | 1.31g/cm3 | Boiling Point | 310.4ºC at 760 mmHg | |
| Molecular Formula | C10H12Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.6ºC | |
| Name | 1-(2,6-dichlorophenyl)-3-propan-2-ylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 310.4ºC at 760 mmHg |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12100 |
| Flash Point | 141.6ºC |
| Exact Mass | 246.03300 |
| PSA | 44.62000 |
| LogP | 3.80070 |
| Index of Refraction | 1.584 |
| InChIKey | VMPFTLYFFVBBES-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)Nc1c(Cl)cccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 275-496-7 |
| 1-(2,6-dichlorophenyl)-3-(propan-2-yl)urea |
| 1-(2,6-Dichlorophenyl)-3-isopropylurea |