2-(2-nitrophenyl)prop-2-enal
Modify Date: 2025-08-27 14:29:44
2-(2-nitrophenyl)prop-2-enal structure
|
Common Name | 2-(2-nitrophenyl)prop-2-enal | ||
|---|---|---|---|---|
| CAS Number | 71463-16-6 | Molecular Weight | 177.15700 | |
| Density | 1.226g/cm3 | Boiling Point | 362ºC at 760 mmHg | |
| Molecular Formula | C9H7NO3 | Melting Point | 53-55ºC | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | 2-(2-nitrophenyl)prop-2-enal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 362ºC at 760 mmHg |
| Melting Point | 53-55ºC |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.15700 |
| Flash Point | 188ºC |
| Exact Mass | 177.04300 |
| PSA | 62.89000 |
| LogP | 2.33010 |
| Index of Refraction | 1.567 |
| InChIKey | FKBCCIUGKJBDJE-UHFFFAOYSA-N |
| SMILES | C=C(C=O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2913000090 |
|---|
|
~94%
2-(2-nitropheny... CAS#:71463-16-6 |
| Literature: Tanaka; Murakami; Torii Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 12 p. 4061 - 4062 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2-(2-Nitrophenyl)acrylaldehyde |
| 2-(2-nitrophenyl)propenal |
| 2-(2-Nitrophenyl)acrolein |
| 2-(1-PHENYLETHYLIDENE)-1-HYDRAZINECARBOXAMIDE |