1,2-Benzisothiazolin-3-one,2,2'-[(methylimino)diethylene]di-, 1,1,1',1'-tetraoxide (8CI) structure
|
Common Name | 1,2-Benzisothiazolin-3-one,2,2'-[(methylimino)diethylene]di-, 1,1,1',1'-tetraoxide (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7145-98-4 | Molecular Weight | 449.50100 | |
| Density | 1.52g/cm3 | Boiling Point | 676.9ºC at 760 mmHg | |
| Molecular Formula | C19H19N3O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.2ºC | |
| Name | 2,2'-((methylazanediyl)bis(ethane-2,1-diyl))bis(benzo[d]isothiazol-3(2H)-one 1,1-dioxide) |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 676.9ºC at 760 mmHg |
| Molecular Formula | C19H19N3O6S2 |
| Molecular Weight | 449.50100 |
| Flash Point | 363.2ºC |
| Exact Mass | 449.07200 |
| PSA | 128.90000 |
| LogP | 2.64500 |
| Index of Refraction | 1.661 |
| InChIKey | PVUCFNGTVZMSGV-UHFFFAOYSA-N |
| SMILES | CN(CCN1C(=O)c2ccccc2S1(=O)=O)CCN1C(=O)c2ccccc2S1(=O)=O |
|
~%
1,2-Benzisothia... CAS#:7145-98-4 |
| Literature: Hamor,G.H.; Balikian,J.M. Journal of the American Pharmaceutical Association, Scientific Edition, 1960 , vol. 49, p. 283 - 284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |