[4-(4-aminophenyl)phenyl]arsonic acid structure
|
Common Name | [4-(4-aminophenyl)phenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 7145-96-2 | Molecular Weight | 293.15000 | |
| Density | N/A | Boiling Point | 562.9ºC at 760 mmHg | |
| Molecular Formula | C12H12AsNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | [4-(4-aminophenyl)phenyl]arsonic acid |
|---|
| Boiling Point | 562.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H12AsNO3 |
| Molecular Weight | 293.15000 |
| Flash Point | 294.2ºC |
| Exact Mass | 293.00300 |
| PSA | 83.55000 |
| LogP | 1.07800 |
| InChIKey | LQPVEFWGCDWANM-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2ccc([As](=O)(O)O)cc2)cc1 |
|
~%
[4-(4-aminophen... CAS#:7145-96-2 |
| Literature: Bauer; Adams Journal of the American Chemical Society, 1924 , vol. 46, p. 1930 |
|
~%
[4-(4-aminophen... CAS#:7145-96-2 |
| Literature: Gerschsow; Lastowskii Zhurnal Prikladnoi Khimii (Sankt-Peterburg, Russian Federation), 1935 , vol. 8, p. 1435,1437 Chem. Zentralbl., 1936 , vol. 107, # I p. 4991 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |