Hydrazinecarbothioamide,2-(1-methyl-2(1H)-quinolinylidene)-
Modify Date: 2025-10-02 12:10:22
Hydrazinecarbothioamide,2-(1-methyl-2(1H)-quinolinylidene)- structure
|
Common Name | Hydrazinecarbothioamide,2-(1-methyl-2(1H)-quinolinylidene)- | ||
|---|---|---|---|---|
| CAS Number | 7145-45-1 | Molecular Weight | 232.30500 | |
| Density | 1.3g/cm3 | Boiling Point | 379ºC at 760mmHg | |
| Molecular Formula | C11H12N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183ºC | |
| Name | [(E)-(1-methylquinolin-2-ylidene)amino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 379ºC at 760mmHg |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.30500 |
| Flash Point | 183ºC |
| Exact Mass | 232.07800 |
| PSA | 87.43000 |
| LogP | 1.91840 |
| Index of Refraction | 1.682 |
| InChIKey | QUTCUYOFOCFOMF-JLHYYAGUSA-N |
| SMILES | Cn1c(=NNC(N)=S)ccc2ccccc21 |
|
~%
Hydrazinecarbot... CAS#:7145-45-1 |
| Literature: Peak; Stansfield Journal of the Chemical Society, 1952 , p. 4067,4071 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-methyl-1H-quinolin-2-one thiosemicarbazone |
| 1-Methyl-1H-chinolin-2-on-thiosemicarbazon |