Dimethyl 2,3,5,6-tetrachloro-4-hydroxyphenyl phosphate
Modify Date: 2025-09-09 22:34:26
Dimethyl 2,3,5,6-tetrachloro-4-hydroxyphenyl phosphate structure
|
Common Name | Dimethyl 2,3,5,6-tetrachloro-4-hydroxyphenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 7144-45-8 | Molecular Weight | 355.92400 | |
| Density | 1.67g/cm3 | Boiling Point | 369.9ºC at 760 mmHg | |
| Molecular Formula | C8H7Cl4O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.5ºC | |
| Name | dimethyl (2,3,5,6-tetrachloro-4-hydroxyphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 369.9ºC at 760 mmHg |
| Molecular Formula | C8H7Cl4O5P |
| Molecular Weight | 355.92400 |
| Flash Point | 177.5ºC |
| Exact Mass | 353.87900 |
| PSA | 74.80000 |
| LogP | 4.78550 |
| Index of Refraction | 1.564 |
| InChIKey | GULABVPLILIUGO-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
|
~%
Dimethyl 2,3,5,... CAS#:7144-45-8 |
| Literature: Ramirez; Dershowitz Journal of the American Chemical Society, 1959 , vol. 81, p. 587,589 |
|
~%
Dimethyl 2,3,5,... CAS#:7144-45-8 |
| Literature: Ramirez; Dershowitz Journal of Organic Chemistry, 1957 , vol. 22, p. 1282 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Dimethyl 2,3,5,6-tetrachloro-4-hydroxyphenyl phosphate |
| Dimethyl(4-hydroxytetrachlorphenyl)phosphonat |
| Phosphorsaeure-dimethylester-(2,3,5,6-tetrachlor-4-hydroxy-phenylester) |
| T0502-9084 |
| phosphoric acid dimethyl ester-(2,3,5,6-tetrachloro-4-hydroxy-phenyl ester) |
| O,O-Dimethyl-O-(4-hydroxy-2,3,5,6-tetrachlor-phenyl)-phosphonat |