2-[(4,5,6-trichloro-1H-benzoimidazol-2-yl)sulfanyl]acetic acid structure
|
Common Name | 2-[(4,5,6-trichloro-1H-benzoimidazol-2-yl)sulfanyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 7144-29-8 | Molecular Weight | 311.57200 | |
| Density | 1.81g/cm3 | Boiling Point | 558.5ºC at 760 mmHg | |
| Molecular Formula | C9H5Cl3N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.6ºC | |
| Name | 2-[(4,5,6-trichloro-1H-benzimidazol-2-yl)sulfanyl]acetic acid |
|---|
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 558.5ºC at 760 mmHg |
| Molecular Formula | C9H5Cl3N2O2S |
| Molecular Weight | 311.57200 |
| Flash Point | 291.6ºC |
| Exact Mass | 309.91400 |
| PSA | 91.28000 |
| LogP | 3.69980 |
| Index of Refraction | 1.744 |
| InChIKey | OGFSVBKMGZSWFK-UHFFFAOYSA-N |
| SMILES | O=C(O)CSc1nc2c(Cl)c(Cl)c(Cl)cc2[nH]1 |
|
~%
2-[(4,5,6-trich... CAS#:7144-29-8 |
| Literature: Rebstock et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 5831 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |