beta-Hydroxy-(1,1'-biphenyl)-4-propanoic acid structure
|
Common Name | beta-Hydroxy-(1,1'-biphenyl)-4-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 71315-37-2 | Molecular Weight | 242.27000 | |
| Density | 1.23g/cm3 | Boiling Point | 447.5ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.6ºC | |
| Name | 3-hydroxy-3-(4-phenylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 447.5ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 238.6ºC |
| Exact Mass | 242.09400 |
| PSA | 57.53000 |
| LogP | 2.86170 |
| Index of Refraction | 1.608 |
| InChIKey | FYLLNQDSIYVIED-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(O)c1ccc(-c2ccccc2)cc1 |
|
~%
beta-Hydroxy-(1... CAS#:71315-37-2 |
| Literature: Cavallini et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 3514,3516 |
|
~%
beta-Hydroxy-(1... CAS#:71315-37-2 |
| Literature: Cavallini et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 3514,3516 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-biphenyl-4-yl-3-hydroxy-propionic acid |
| 3-(biphenyl-4-yl)-3-hydroxypropanoic acid |
| 3-Biphenyl-4-yl-3-hydroxy-propionsaeure |