2-(9,10-dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-8-ylidene)-3-oxo-butyric acid ethyl ester structure
|
Common Name | 2-(9,10-dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-8-ylidene)-3-oxo-butyric acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 71266-91-6 | Molecular Weight | 463.47900 | |
| Density | 1.38g/cm3 | Boiling Point | 654.4ºC at 760 mmHg | |
| Molecular Formula | C26H25NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.5ºC | |
| Name | 2-(9,10-dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-8-ylidene)-3-oxo-butyric acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 654.4ºC at 760 mmHg |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.47900 |
| Flash Point | 349.5ºC |
| Exact Mass | 463.16300 |
| PSA | 85.22000 |
| LogP | 3.19420 |
| Index of Refraction | 1.647 |
| InChIKey | OODWUNAKSQPKKC-GYHWCHFESA-N |
| SMILES | CCOC(=O)C(C(C)=O)=C1c2c(ccc(OC)c2OC)C=C2c3cc4c(cc3CCN21)OCO4 |
|
~%
2-(9,10-dimetho... CAS#:71266-91-6 |
| Literature: Moniot; Kravetz; El Rahman Abd El Rahman; Shamma Journal of Pharmaceutical Sciences, 1979 , vol. 68, # 6 p. 705 - 708 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Ethyl 8-berberinylidenacetoacetat |