2-anilino-5-bromoterephthalic acid structure
|
Common Name | 2-anilino-5-bromoterephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 71033-00-6 | Molecular Weight | 336.13800 | |
| Density | 1.708g/cm3 | Boiling Point | 493ºC at 760 mmHg | |
| Molecular Formula | C14H10BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252ºC | |
| Name | 2-anilino-5-bromoterephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.708g/cm3 |
|---|---|
| Boiling Point | 493ºC at 760 mmHg |
| Molecular Formula | C14H10BrNO4 |
| Molecular Weight | 336.13800 |
| Flash Point | 252ºC |
| Exact Mass | 334.97900 |
| PSA | 86.63000 |
| LogP | 3.66210 |
| Index of Refraction | 1.713 |
| InChIKey | XEXVUFBWMIYKRM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Nc2ccccc2)c(C(=O)O)cc1Br |
| HS Code | 2922499990 |
|---|
|
~%
2-anilino-5-bro... CAS#:71033-00-6 |
| Literature: Lesnianski; Czerski Roczniki Chemii, vol. 6, p. 891,892 Chem. Zentralbl., 1927 , vol. 98, # I p. 3006 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-(PHENYLAMINO)-5-BROMOTEREPHTHALIC ACID |
| 2-Anilino-5-brom-terephthalsaeure |
| 2-anilino-5-bromoterephthalicacid |
| 4-Brom-diphenylamin-dicarbonsaeure-(2.5) |