Diethyl 2,2'-(1,3-dioxolane-2,2-diyl)diacetate structure
|
Common Name | Diethyl 2,2'-(1,3-dioxolane-2,2-diyl)diacetate | ||
|---|---|---|---|---|
| CAS Number | 71022-90-7 | Molecular Weight | 246.257 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 300.5±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.9±21.0 °C | |
| Name | ethyl 2-[2-(2-ethoxy-2-oxoethyl)-1,3-dioxolan-2-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.5±17.0 °C at 760 mmHg |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.257 |
| Flash Point | 127.9±21.0 °C |
| Exact Mass | 246.110336 |
| PSA | 71.06000 |
| LogP | 1.35 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | YNNQXNJEKFCZLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(CC(=O)OCC)OCCO1 |
| HS Code | 2932999099 |
|---|
|
~92%
Diethyl 2,2'-(1... CAS#:71022-90-7 |
| Literature: Yang, Donglai; Arifhodzic, Lejla; Ganellin, C. Robin; Jenkinson, Donald H. European Journal of Medicinal Chemistry, 2013 , vol. 63, p. 907 - 923 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AB3689 |
| 1,3-Dioxolane-2,2-diacetic acid, diethyl ester |
| 1,3-Dioxolane-2,2-diacetic acid,diethyl ester |
| diethyl 3,3-(ethylenedioxy)glutarate |
| Diethyl 2,2'-(1,3-dioxolane-2,2-diyl)diacetate |
| 2,2-Bis-aethoxycarbonylmethyl-[1,3]dioxolan |
| 2,2-bis-ethoxycarbonylmethyl-[1,3]dioxolane |