[2-[[2,2-bis(hydroxymethyl)-3-pentanoyloxypropoxy]methyl]-2-(heptanoyloxymethyl)-3-octanoyloxypropyl] decanoate structure
|
Common Name | [2-[[2,2-bis(hydroxymethyl)-3-pentanoyloxypropoxy]methyl]-2-(heptanoyloxymethyl)-3-octanoyloxypropyl] decanoate | ||
|---|---|---|---|---|
| CAS Number | 71010-75-8 | Molecular Weight | 731.00900 | |
| Density | 1.038g/cm3 | Boiling Point | 746ºC at 760 mmHg | |
| Molecular Formula | C40H74O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.8ºC | |
| Name | [2-[[2,2-bis(hydroxymethyl)-3-pentanoyloxypropoxy]methyl]-2-(heptanoyloxymethyl)-3-octanoyloxypropyl] decanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 746ºC at 760 mmHg |
| Molecular Formula | C40H74O11 |
| Molecular Weight | 731.00900 |
| Flash Point | 206.8ºC |
| Exact Mass | 730.52300 |
| PSA | 154.89000 |
| LogP | 7.79500 |
| Index of Refraction | 1.477 |
| InChIKey | BHGLOIRUBLRHKK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OCC(COCC(CO)(CO)COC(=O)CCCC)(COC(=O)CCCCCC)COC(=O)CCCCCCC |
| Dipentaerythritol,ester with valeric acid,enanthylic acid,caprylic acid,and capric acid |
| Decanoic acid mixed esters with dipentaerythritol heptanoic acid octanoic acid and valeric acid |