Pirazolac structure
|
Common Name | Pirazolac | ||
|---|---|---|---|---|
| CAS Number | 71002-09-0 | Molecular Weight | 330.74100 | |
| Density | 1.36g/cm3 | Boiling Point | 520.8ºC at 760 mmHg | |
| Molecular Formula | C17H12ClFN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
Use of PirazolacPirazolac is a non-steroidal anti-inflammatory drug. |
| Name | 2-[4-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Pirazolac is a non-steroidal anti-inflammatory drug. |
|---|---|
| Related Catalog | |
| In Vitro | Pirazolac is a non-steroidal anti-inflammatory drug. Pirazolac concentration-relatedly inhibits the accumulation of prostanoids in incubates of human gastric mucosa, but this inhibition is less than that by indomethacin and other commonly used non-steroidal anti-inflammatory drugs. This difference may explain the claim that Pirazolac is less damaging to the stomach[1]. |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 520.8ºC at 760 mmHg |
| Molecular Formula | C17H12ClFN2O2 |
| Molecular Weight | 330.74100 |
| Flash Point | 268.8ºC |
| Exact Mass | 330.05700 |
| PSA | 55.12000 |
| LogP | 3.95890 |
| Index of Refraction | 1.629 |
| InChIKey | YAMFWQIVVMITPG-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1nn(-c2ccc(F)cc2)cc1-c1ccc(Cl)cc1 |
| Storage condition | 2-8℃ |
| HS Code | 2933199090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pirazolaco |
| [1-(4-Fluorophenyl)-4-(4-chlorophenyl)-1H-pyrazol-3-yl]-acetic acid |
| 4-(4-Chlorphenyl)-1-(4-fluorphenyl)-pyrazol-3-essigsaeure |
| Pirazolacum |
| Pirazolacum [INN-Latin] |
| Pirazolac (USAN/INN) |
| PIRAZOLAC |
| 4-(4-chlorophenyl)-1-(4-fluorophenyl)-3-pyrazolylacetic acid |
| Pirazolaco [INN-Spanish] |