butane-1,3-diol,dimethyl 2-(2-ethylhexyl)pentanedioate,dimethyl hexanedioate
Modify Date: 2025-09-27 16:04:34
butane-1,3-diol,dimethyl 2-(2-ethylhexyl)pentanedioate,dimethyl hexanedioate structure
|
Common Name | butane-1,3-diol,dimethyl 2-(2-ethylhexyl)pentanedioate,dimethyl hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 70983-42-5 | Molecular Weight | 536.69600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H52O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butane-1,3-diol,dimethyl 2-(2-ethylhexyl)pentanedioate,dimethyl hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H52O10 |
|---|---|
| Molecular Weight | 536.69600 |
| Exact Mass | 536.35600 |
| PSA | 145.66000 |
| LogP | 3.97770 |
| InChIKey | YWPBNTMMRJGVNJ-UHFFFAOYSA-N |
| SMILES | CC(O)CCO.CCCCC(CC)CC(CCC(=O)OC)C(=O)OC.COC(=O)CCCCC(=O)OC |
| Hexanedioic acid,dimethyl ester,polymer with 1,3-butanediol and dimethyl pentanedioate,2-ethylhexyl ester |
| Hexanedioic acid,1,6-dimethyl ester,polymer with 1,3-butanediol and 1,5-dimethyl pentanedioate,2-ethylhexyl ester |