N-ethyl-N-(2-methylphenyl)benzamide structure
|
Common Name | N-ethyl-N-(2-methylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 7097-81-6 | Molecular Weight | 239.31200 | |
| Density | 1.089g/cm3 | Boiling Point | 368.7ºC at 760 mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.6ºC | |
| Name | N-ethyl-N-(2-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 368.7ºC at 760 mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 164.6ºC |
| Exact Mass | 239.13100 |
| PSA | 20.31000 |
| LogP | 3.66170 |
| Index of Refraction | 1.598 |
| InChIKey | OPKOGUYXDTVGMV-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)c1ccccc1)c1ccccc1C |
|
~%
N-ethyl-N-(2-me... CAS#:7097-81-6 |
| Literature: Leister; Tarbell Journal of Organic Chemistry, 1958 , vol. 23, p. 1152,1155 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzoesaeure-N-ethyl-N-(2-methyl-phenyl)-amid |
| benzoic acid-(N-ethyl-o-toluidide) |
| N-Aethyl-(benz-o-toluidid) |
| Benzoesaeure-(N-aethyl-o-toluidid) |