tert-butyl (2S)-2-carbamoyl-2,3-dihydropyrrole-1-carboxylate
Modify Date: 2025-08-25 01:16:48
tert-butyl (2S)-2-carbamoyl-2,3-dihydropyrrole-1-carboxylate structure
|
Common Name | tert-butyl (2S)-2-carbamoyl-2,3-dihydropyrrole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 709031-38-9 | Molecular Weight | 212.246 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 386.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5±27.9 °C | |
| Name | tert-butyl (2S)-2-carbamoyl-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.5±42.0 °C at 760 mmHg |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.246 |
| Flash Point | 187.5±27.9 °C |
| Exact Mass | 212.116089 |
| PSA | 73.62000 |
| LogP | -0.20 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | ZDKSDALJIXEHOP-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CCC1C(N)=O |
| HS Code | 2933990090 |
|---|
![(1S,3S,5S)-3-(Aminocarbonyl)-2-azabicyclo[3.1.0]hexane-2-carboxylic acid tert-butyl ester structure](https://image.chemsrc.com/caspic/330/361440-67-7.png)
CAS#:361440-67-7![tert-butyl N-[(1S)-2-[(1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexan-2-yl]-1-(3-hydroxy-1-adamantyl)-2-oxoethyl]carbamate structure](https://image.chemsrc.com/caspic/118/361442-01-5.png)
CAS#:361442-01-5![N-[(1S)-2-[(1S,3S,5S)-3-Cyano-2-azabicyclo[3.1.0]hex-2-yl]-1-(3-hydroxytricyclo[3.3.1.13,7]dec-1-yl)-2-oxoethyl]carbamic acid 1,1-dimethylethyl ester structure](https://image.chemsrc.com/caspic/495/709031-43-6.png)
CAS#:709031-43-6![(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide methanesulfonate structure](https://image.chemsrc.com/caspic/419/709031-45-8.png)
CAS#:709031-45-8| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl [(2S)-2,3-dihydro-1H-pyrrol-2-ylcarbonyl]carbamate |
| tert-Butyl (2S)-2-carbamoyl-2,3-dihydro-1H-pyrrole-1-carboxylate |
| 1H-Pyrrole-1-carboxylic acid, 2-(aminocarbonyl)-2,3-dihydro-, 1,1-dimethylethyl ester, (2S)- |
| Carbamic acid, N-[[(2S)-2,3-dihydro-1H-pyrrol-2-yl]carbonyl]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (2S)-2-carbamoyl-2,3-dihydro-1H-pyrrole-1-carboxylate |
| pyr318 |