L-Serinamide,N-[(phenylmethoxy)carbonyl]-L-alanyl- (9CI) structure
|
Common Name | L-Serinamide,N-[(phenylmethoxy)carbonyl]-L-alanyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 70874-14-5 | Molecular Weight | 309.31800 | |
| Density | 1.296g/cm3 | Boiling Point | 655.5ºC at 760mmHg | |
| Molecular Formula | C14H19N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.2ºC | |
| Name | benzyl N-[1-[(1-amino-3-hydroxy-1-oxopropan-2-yl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 655.5ºC at 760mmHg |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.31800 |
| Flash Point | 350.2ºC |
| Exact Mass | 309.13200 |
| PSA | 130.75000 |
| LogP | 0.74580 |
| Index of Refraction | 1.564 |
| InChIKey | FGEFRNRUJYXIDD-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(CO)C(N)=O |
|
~%
L-Serinamide,N-... CAS#:70874-14-5 |
| Literature: Kitada; Ashida; Maki; Fujino; Hirai; Yasuhara; Nakajima; Takeyama; Koyama; Yajima Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 3 p. 887 - 892 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-Carbobenzoxy-L-alanyl-L-serinamide |
| Z-Ala-Ser-NH2 |