2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitro-benzene
Modify Date: 2025-09-15 19:16:32
2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitro-benzene structure
|
Common Name | 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 70862-29-2 | Molecular Weight | 393.22200 | |
| Density | 1.708g/cm3 | Boiling Point | 508.3ºC at 760 mmHg | |
| Molecular Formula | C13H7N5O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.6ºC | |
| Name | 2-(2,4-dinitrophenyl)-4-methyl-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.708g/cm3 |
|---|---|
| Boiling Point | 508.3ºC at 760 mmHg |
| Molecular Formula | C13H7N5O10 |
| Molecular Weight | 393.22200 |
| Flash Point | 241.6ºC |
| Exact Mass | 393.01900 |
| PSA | 229.10000 |
| LogP | 5.81900 |
| Index of Refraction | 1.694 |
| InChIKey | QFHXXZWSRJRXBK-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])c(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1[N+](=O)[O-] |
|
~%
2-(2,4-dinitrop... CAS#:70862-29-2 |
| Literature: Stearns; Adams Journal of the American Chemical Society, 1930 , vol. 52, p. 2070,2073, 2074 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Methyl-2,4,6,2',4'-pentanitro-biphenyl |