SP-Chymostatin B
Modify Date: 2024-01-03 10:40:42
SP-Chymostatin B structure
|
Common Name | SP-Chymostatin B | ||
|---|---|---|---|---|
| CAS Number | 70857-49-7 | Molecular Weight | 595.701 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H41N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SP-Chymostatin BSP-Chymostatin B is a potent inhibitor of many proteases, including chymotrypsin, papain, chymotrypsin-like serine proteinases, chymases, and lysosomal cysteine proteinases. It weakly inhibits human leucocyte elastase. It is effective at a final concentration of 100 to 200 μg/ml (10 to 100 μM). |
| Name | SP-Chymostatin B |
|---|
| Description | SP-Chymostatin B is a potent inhibitor of many proteases, including chymotrypsin, papain, chymotrypsin-like serine proteinases, chymases, and lysosomal cysteine proteinases. It weakly inhibits human leucocyte elastase. It is effective at a final concentration of 100 to 200 μg/ml (10 to 100 μM). |
|---|---|
| References | 1. Haas KM. B-1 lymphocytes in mice and nonhuman primates. Ann N Y Acad Sci. 2015 Dec;1362:98-109. doi: 10.1111/nyas.12760. Epub 2015 Apr 30. Review. PubMed PMID: 25930711; PubMed Central PMCID: PMC4627897. |
| Molecular Formula | C30H41N7O6 |
|---|---|
| Molecular Weight | 595.701 |
| InChIKey | SABSBIPNNYDZRS-QORCZRPOSA-N |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)NC(Cc1ccccc1)C(=O)O)C(=O)NC(C=O)Cc1ccccc1 |