Hexanoicacid, 4,4,5,5,6,6,6-heptafluoro-3-(nitromethyl)-
Modify Date: 2025-08-25 18:30:40
Hexanoicacid, 4,4,5,5,6,6,6-heptafluoro-3-(nitromethyl)- structure
|
Common Name | Hexanoicacid, 4,4,5,5,6,6,6-heptafluoro-3-(nitromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 7079-86-9 | Molecular Weight | 301.11600 | |
| Density | 1.583g/cm3 | Boiling Point | 290.1ºC at 760mmHg | |
| Molecular Formula | C7H6F7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.3ºC | |
| Name | 4,4,5,5,6,6,6-heptafluoro-3-(nitromethyl)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.583g/cm3 |
|---|---|
| Boiling Point | 290.1ºC at 760mmHg |
| Molecular Formula | C7H6F7NO4 |
| Molecular Weight | 301.11600 |
| Flash Point | 129.3ºC |
| Exact Mass | 301.01900 |
| PSA | 83.12000 |
| LogP | 2.71010 |
| Index of Refraction | 1.37 |
| InChIKey | MMHHDSOESNPFFR-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(C[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)F |
|
~%
Hexanoicacid, 4... CAS#:7079-86-9 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,4,5,5,6,6,6-heptafluoro-3-nitromethyl-hexanoic acid |
| 4,4,5,5,6,6,6-Heptafluor-3-nitromethyl-hexansaeure |
| Hexanoicacid,4,4,5,5,6,6,6-heptafluoro-3-(nitromethyl) |