4-(3,4-dimethoxyphenyl)cyclohex-3-en-1-one structure
|
Common Name | 4-(3,4-dimethoxyphenyl)cyclohex-3-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 70779-48-5 | Molecular Weight | 232.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,4-dimethoxyphenyl)cyclohex-3-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O3 |
|---|---|
| Molecular Weight | 232.27500 |
| Exact Mass | 232.11000 |
| PSA | 35.53000 |
| LogP | 2.84020 |
| InChIKey | VXTGOLYFZNRLJL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=CCC(=O)CC2)cc1OC |
|
~%
4-(3,4-dimethox... CAS#:70779-48-5 |
| Literature: Hoshino, Osamu; Sawaki, Shohei; Shimamura, Naomi; Onodera, Akira; Umezawa, Bunsuke Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 7 p. 2734 - 2743 |
|
~%
4-(3,4-dimethox... CAS#:70779-48-5 |
| Literature: Hoshino, Osamu; Sawaki, Shohei; Shimamura, Naomi; Onodera, Akira; Umezawa, Bunsuke Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 7 p. 2734 - 2743 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Cyclohexen-1-one,4-(3,4-dimethoxyphenyl) |