Phosphorodiamidic acid,N,N'-bis(2-chloroethyl)-, phenyl ester structure
|
Common Name | Phosphorodiamidic acid,N,N'-bis(2-chloroethyl)-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 70772-68-8 | Molecular Weight | 297.11800 | |
| Density | 1.305g/cm3 | Boiling Point | 387.3ºC at 760 mmHg | |
| Molecular Formula | C10H15Cl2N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | 2-chloro-N-[(2-chloroethylamino)-phenoxyphosphoryl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 387.3ºC at 760 mmHg |
| Molecular Formula | C10H15Cl2N2O2P |
| Molecular Weight | 297.11800 |
| Flash Point | 188.1ºC |
| Exact Mass | 296.02500 |
| PSA | 60.17000 |
| LogP | 3.61210 |
| Index of Refraction | 1.532 |
| InChIKey | MXGQLWMLQRDZBT-UHFFFAOYSA-N |
| SMILES | O=P(NCCCl)(NCCCl)Oc1ccccc1 |
|
~85%
Phosphorodiamid... CAS#:70772-68-8 |
| Literature: Roux, Charlotte le; Modro, Agnes M.; Modro, Tomasz A. Journal of Chemical Research, Synopses, 1995 , # 1 p. 38 - 39 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Phenylphosphorsaeureester-N,N'-(2-chlorethyl)diamid |
| PHENYL N,N'-BIS(2-CHLOROETHYL)PHOSPHORODIAMIDATE |
| Phosphorodiamidic acid,N,N'-bis(2-chloroethyl)-,phenyl ester |