[2,3-dimethoxy-5-(morpholine-4-carbothioyl)phenyl] acetate
Modify Date: 2025-08-25 12:27:35
![[2,3-dimethoxy-5-(morpholine-4-carbothioyl)phenyl] acetate Structure](https://image.chemsrc.com/caspic/004/70733-90-3.png)
[2,3-dimethoxy-5-(morpholine-4-carbothioyl)phenyl] acetate structure
|
Common Name | [2,3-dimethoxy-5-(morpholine-4-carbothioyl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 70733-90-3 | Molecular Weight | 325.38000 | |
| Density | 1.255g/cm3 | Boiling Point | 440.1ºC at 760 mmHg | |
| Molecular Formula | C15H19NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220ºC | |
| Name | [2,3-dimethoxy-5-(morpholine-4-carbothioyl)phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 440.1ºC at 760 mmHg |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.38000 |
| Flash Point | 220ºC |
| Exact Mass | 325.09800 |
| PSA | 89.32000 |
| LogP | 1.57470 |
| Index of Refraction | 1.571 |
| InChIKey | GOWLZUBHTOQIJE-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=S)N2CCOCC2)cc(OC(C)=O)c1OC |
|
~%
[2,3-dimethoxy-... CAS#:70733-90-3 |
| Literature: Farina; Pinza; Gamba; Pifferi European Journal of Medicinal Chemistry, 1979 , vol. 14, # 1 p. 27 - 31 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:70733-91-4| 4-((3-(Acetyloxy)-4,5-dimethoxyphenyl)thioxomethyl)morpholine |
| Morpholine,4-((3-(acetyloxy)-4,5-dimethoxyphenyl)thioxomethyl) |
| 4-(3-acetoxy-4,5-dimethoxy-thiobenzoyl)-morpholine |