9H-Fluorene-2,7-diamine,N2,N2-dimethyl- structure
|
Common Name | 9H-Fluorene-2,7-diamine,N2,N2-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 70730-50-6 | Molecular Weight | 224.30100 | |
| Density | 1.189g/cm3 | Boiling Point | 443.7ºC at 760mmHg | |
| Molecular Formula | C15H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | 2-N,2-N-dimethyl-9H-fluorene-2,7-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 443.7ºC at 760mmHg |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30100 |
| Flash Point | 191ºC |
| Exact Mass | 224.13100 |
| PSA | 29.26000 |
| LogP | 3.48720 |
| Index of Refraction | 1.693 |
| InChIKey | MGICMVJMBLEWCI-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(c1)Cc1cc(N)ccc1-2 |
|
~%
9H-Fluorene-2,7... CAS#:70730-50-6 |
| Literature: Kang, Iou-Jiun; Wang, Li-Wen; Yeh, Teng-Kuang; Lee, Chung-Chi; Lee, Yen-Chun; Hsu, Sheng-Ju; Wu, Yen-Shian; Wang, Jing-Chyi; Chao, Yu-Sheng; Yueh, Andrew; Chern, Jyh-Haur Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 17 p. 6414 - 6421 |
|
~%
9H-Fluorene-2,7... CAS#:70730-50-6 |
| Literature: Fletcher; Namkung Journal of Organic Chemistry, 1958 , vol. 23, p. 680,683 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N-Dimethyl-fluoren-2,7-diyldiamin |
| N,N-dimethyl-fluorene-2,7-diyldiamine |