(R)-TERT-BUTYL (1-AMINO-3-METHYL-1-OXOBUTAN-2-YL)CARBAMATE
Modify Date: 2025-08-22 13:35:20
(R)-TERT-BUTYL (1-AMINO-3-METHYL-1-OXOBUTAN-2-YL)CARBAMATE structure
|
Common Name | (R)-TERT-BUTYL (1-AMINO-3-METHYL-1-OXOBUTAN-2-YL)CARBAMATE | ||
|---|---|---|---|---|
| CAS Number | 70717-76-9 | Molecular Weight | 216.27700 | |
| Density | 1.042 | Boiling Point | 361.7ºC at 760 mmHg | |
| Molecular Formula | C10H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | tert-butyl N-[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042 |
|---|---|
| Boiling Point | 361.7ºC at 760 mmHg |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.27700 |
| Flash Point | 172.6ºC |
| Exact Mass | 216.14700 |
| PSA | 81.42000 |
| LogP | 2.11220 |
| Index of Refraction | 1.463 |
| InChIKey | NZSZYROZOXUFSG-SSDOTTSWSA-N |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(N)=O |
| HS Code | 2924199090 |
|---|
|
~94%
(R)-TERT-BUTYL ... CAS#:70717-76-9 |
| Literature: Xia; Smith Journal of Organic Chemistry, 2001 , vol. 66, # 10 p. 3459 - 3466 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (R)-(1-carbamoyl-2-methyl-propyl)-carbamicacidtert-butyl ester |
| N-t-butyloxycarbonyl-(R)-valinimide |
| (R)-tert-Butyl (1-amino-3-methyl-1-oxobutan-2-yl)carbamate |
| boc-D-valine amide |
| N-Boc-D-valine amide |