2-methylaziridine,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid structure
|
Common Name | 2-methylaziridine,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 70715-05-8 | Molecular Weight | 243.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylaziridine,methyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H21NO4 |
|---|---|
| Molecular Weight | 243.29900 |
| Exact Mass | 243.14700 |
| PSA | 85.54000 |
| LogP | 1.68950 |
| InChIKey | JPAOASCADIKNKG-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC.CC1CN1 |
| Methyl methacrylate,methacrylic acid polymer,compd. with propyleneimine |
| 2-Propenoic acid,2-methyl-,polymer with methyl 2-methyl-2-propenoate,compd. with 2-methylaziridine |