butane-1,4-diol,1,4-diisocyanatobenzene,hexanedioic acid
Modify Date: 2025-08-25 23:06:26
butane-1,4-diol,1,4-diisocyanatobenzene,hexanedioic acid structure
|
Common Name | butane-1,4-diol,1,4-diisocyanatobenzene,hexanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 70714-86-2 | Molecular Weight | 396.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butane-1,4-diol,1,4-diisocyanatobenzene,hexanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H24N2O8 |
|---|---|
| Molecular Weight | 396.39200 |
| Exact Mass | 396.15300 |
| PSA | 173.92000 |
| LogP | 2.08840 |
| InChIKey | QAEWCCSJRRYRPK-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)O.O=C=Nc1ccc(N=C=O)cc1.OCCCCO |
| 1,4-Butanediol,hexanedioic acid,1,4-diisocyanatobenzene polymer |
| Hexanedioic acid,polymer with 1,4-butanediol and 1,4-diisocyanatobenzene |