Sodium 3-oxo-3-phenylpropanoate structure
|
Common Name | Sodium 3-oxo-3-phenylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 7063-21-0 | Molecular Weight | 515.73400 | |
| Density | 1.25g/cm3 | Boiling Point | 517.1°C at 760 mmHg | |
| Molecular Formula | C26H37N5O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.5°C | |
| Name | Sodium 3-oxo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 517.1°C at 760 mmHg |
| Molecular Formula | C26H37N5O2S2 |
| Molecular Weight | 515.73400 |
| Flash Point | 266.5°C |
| Exact Mass | 515.23900 |
| PSA | 129.97000 |
| LogP | 4.06568 |
| InChIKey | ALIIURBGZRQXFQ-UHFFFAOYSA-M |
| SMILES | O=C([O-])CC(=O)c1ccccc1.[Na+] |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD27920688 |