1,2,4,5-tetramethyl-3,6-bis(thiocyanatomethyl)benzene
Modify Date: 2025-08-25 08:01:29
1,2,4,5-tetramethyl-3,6-bis(thiocyanatomethyl)benzene structure
|
Common Name | 1,2,4,5-tetramethyl-3,6-bis(thiocyanatomethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 70477-55-3 | Molecular Weight | 276.42000 | |
| Density | 1.176g/cm3 | Boiling Point | 451.4ºC at 760 mmHg | |
| Molecular Formula | C14H16N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | [2,3,5,6-tetramethyl-4-(thiocyanatomethyl)phenyl]methyl thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 451.4ºC at 760 mmHg |
| Molecular Formula | C14H16N2S2 |
| Molecular Weight | 276.42000 |
| Flash Point | 226.8ºC |
| Exact Mass | 276.07500 |
| PSA | 98.18000 |
| LogP | 4.34876 |
| Index of Refraction | 1.601 |
| InChIKey | QOBUTQBFVKUEQN-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(CSC#N)c(C)c(C)c1CSC#N |
|
~%
1,2,4,5-tetrame... CAS#:70477-55-3 |
| Literature: Suzuki,H. et al. Bulletin of the Chemical Society of Japan, 1979 , vol. 52, # 3 p. 836 - 840 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2,4,5-Tetramethyl-3,6-bis(thiocyanatomethyl)benzol |