sodium salt of N-acetyl-L-phenylalanine
Modify Date: 2025-09-20 20:17:43
sodium salt of N-acetyl-L-phenylalanine structure
|
Common Name | sodium salt of N-acetyl-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 70461-63-1 | Molecular Weight | 229.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12NNaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium salt of N-acetyl-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12NNaO3 |
|---|---|
| Molecular Weight | 229.20800 |
| Exact Mass | 229.07100 |
| PSA | 69.23000 |
| InChIKey | RBMBEFVVHHNLAR-PPHPATTJSA-M |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)[O-].[Na+] |
| N-acetyl-L-phenylalanine, sodium salt |
| Sodium |
| (S)-2-acetylamino-3-phenyl-propionate |
| Ac-Phe-ONa |
| N-acetyl-L-phenylalanine sodium salt |