2-[3-(trifluoromethyl)anilino]pyridine-3-carbonyl chloride structure
|
Common Name | 2-[3-(trifluoromethyl)anilino]pyridine-3-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 70458-49-0 | Molecular Weight | 300.66400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8ClF3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3-(trifluoromethyl)anilino]pyridine-3-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8ClF3N2O |
|---|---|
| Molecular Weight | 300.66400 |
| Exact Mass | 300.02800 |
| PSA | 41.99000 |
| LogP | 4.29600 |
| InChIKey | HYNJKBCUZJEDNV-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
|
~76%
2-[3-(trifluoro... CAS#:70458-49-0 |
| Literature: Criddle; Meireles; MacEdo; Leal-Cardoso; Scarparo; Jaffar Journal of Pharmacy and Pharmacology, 2002 , vol. 54, # 2 p. 283 - 288 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-{[3-(Trifluoromethyl)phenyl]amino}nicotinoyl chloride |
| 3-Pyridinecarbonyl chloride,2-[[3-(trifluoromethyl)phenyl]amino] |
| niflumic acid chloride |